Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethylbenzene, 99.8%, pure
CAS: 100-41-4 MDL Number: MFCD00011647 InChI Key: YNQLUTRBYVCPMQ-UHFFFAOYSA-N Synonym: phenylethane,ethylbenzol,benzene, ethyl,aethylbenzol,ethylenzene,ethyl benzene,ethylbenzeen,etilbenzene,etylobenzen,alpha-methyltoluene PubChem CID: 7500 ChEBI: CHEBI:16101 IUPAC Name: ethylbenzene SMILES: CCC1=CC=CC=C1
| PubChem CID | 7500 |
|---|---|
| CAS | 100-41-4 |
| ChEBI | CHEBI:16101 |
| MDL Number | MFCD00011647 |
| SMILES | CCC1=CC=CC=C1 |
| Synonym | phenylethane,ethylbenzol,benzene, ethyl,aethylbenzol,ethylenzene,ethyl benzene,ethylbenzeen,etilbenzene,etylobenzen,alpha-methyltoluene |
| IUPAC Name | ethylbenzene |
| InChI Key | YNQLUTRBYVCPMQ-UHFFFAOYSA-N |
n-Dodecane, 99%
CAS: 112-40-3 Molecular Formula: C12H26 Molecular Weight (g/mol): 170.34 MDL Number: MFCD00008969 InChI Key: SNRUBQQJIBEYMU-UHFFFAOYSA-N Synonym: n-dodecane,dihexyl,bihexyl,adakane 12,n-dodecan,n-dodecan german,duodecane,alkanes, c10-14,undecane, methyl,ccris 661 PubChem CID: 8182 ChEBI: CHEBI:28817 IUPAC Name: dodecane SMILES: CCCCCCCCCCCC
| PubChem CID | 8182 |
|---|---|
| CAS | 112-40-3 |
| Molecular Weight (g/mol) | 170.34 |
| ChEBI | CHEBI:28817 |
| MDL Number | MFCD00008969 |
| SMILES | CCCCCCCCCCCC |
| Synonym | n-dodecane,dihexyl,bihexyl,adakane 12,n-dodecan,n-dodecan german,duodecane,alkanes, c10-14,undecane, methyl,ccris 661 |
| IUPAC Name | dodecane |
| InChI Key | SNRUBQQJIBEYMU-UHFFFAOYSA-N |
| Molecular Formula | C12H26 |
Disodium hydrogen citrate sesquihydrate, 99%
CAS: 5-4-6132 Molecular Formula: C12H18Na4O17 Molecular Weight (g/mol): 526.22 MDL Number: MFCD00150445 InChI Key: HGPVLOQNBSHYEI-UHFFFAOYNA-J Synonym: unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 PubChem CID: 117063816 IUPAC Name: tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate SMILES: C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+]
| PubChem CID | 117063816 |
|---|---|
| CAS | 5-4-6132 |
| Molecular Weight (g/mol) | 526.22 |
| MDL Number | MFCD00150445 |
| SMILES | C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+] |
| Synonym | unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 |
| IUPAC Name | tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate |
| InChI Key | HGPVLOQNBSHYEI-UHFFFAOYNA-J |
| Molecular Formula | C12H18Na4O17 |
Gossypol, 98+%
CAS: 303-45-7 Molecular Formula: C30H30O8 Molecular Weight (g/mol): 518.56 MDL Number: MFCD00017352 InChI Key: QBKSWRVVCFFDOT-UHFFFAOYSA-N Synonym: gossypol,--gossypol,+-gossypol,pogosin,tash 1,racemic-gossypol,r---gossypol,r-gossypol,+--gossypol,+/--gossypol PubChem CID: 3503 ChEBI: CHEBI:28584 SMILES: CC(C)C1=C(O)C(O)=C(C=O)C2=C(O)C(=C(C)C=C12)C1=C(O)C2=C(C=O)C(O)=C(O)C(C(C)C)=C2C=C1C
| PubChem CID | 3503 |
|---|---|
| CAS | 303-45-7 |
| Molecular Weight (g/mol) | 518.56 |
| ChEBI | CHEBI:28584 |
| MDL Number | MFCD00017352 |
| SMILES | CC(C)C1=C(O)C(O)=C(C=O)C2=C(O)C(=C(C)C=C12)C1=C(O)C2=C(C=O)C(O)=C(O)C(C(C)C)=C2C=C1C |
| Synonym | gossypol,--gossypol,+-gossypol,pogosin,tash 1,racemic-gossypol,r---gossypol,r-gossypol,+--gossypol,+/--gossypol |
| InChI Key | QBKSWRVVCFFDOT-UHFFFAOYSA-N |
| Molecular Formula | C30H30O8 |
Thermo Scientific Chemicals Calconcarboxylic acid, indicator grade
CAS: 3737-95-9 Molecular Formula: C21H14N2O7S Molecular Weight (g/mol): 438.4 MDL Number: MFCD00004078 InChI Key: ULIVOAKVRBXKKS-PYCFMQQDSA-N Synonym: calconcarboxylic acid,patton-reeder indicator,calconcarbonic acid,calcon 3-carboxylic acid,patton and reeder's indicator,2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid,2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid,2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo,nn PubChem CID: 5895210 IUPAC Name: 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid SMILES: C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O
| PubChem CID | 5895210 |
|---|---|
| CAS | 3737-95-9 |
| Molecular Weight (g/mol) | 438.4 |
| MDL Number | MFCD00004078 |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O |
| Synonym | calconcarboxylic acid,patton-reeder indicator,calconcarbonic acid,calcon 3-carboxylic acid,patton and reeder's indicator,2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid,2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid,2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo,nn |
| IUPAC Name | 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid |
| InChI Key | ULIVOAKVRBXKKS-PYCFMQQDSA-N |
| Molecular Formula | C21H14N2O7S |
Glycidyl methacrylate, 97%, stab. with 100ppm 4-methoxyphenol
CAS: 106-91-2 Molecular Formula: C7H10O3 Molecular Weight (g/mol): 142.154 MDL Number: MFCD00005137 InChI Key: VOZRXNHHFUQHIL-UHFFFAOYSA-N Synonym: glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane PubChem CID: 7837 IUPAC Name: oxiran-2-ylmethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC1CO1
| PubChem CID | 7837 |
|---|---|
| CAS | 106-91-2 |
| Molecular Weight (g/mol) | 142.154 |
| MDL Number | MFCD00005137 |
| SMILES | CC(=C)C(=O)OCC1CO1 |
| Synonym | glycidyl methacrylate,2,3-epoxypropyl methacrylate,sy-monomer g,glycidol methacrylate,acriester g,blemmer g,blemmer gma,light ester g,glycidylmethacrylate,2-methacryloxy methyl oxirane |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate |
| InChI Key | VOZRXNHHFUQHIL-UHFFFAOYSA-N |
| Molecular Formula | C7H10O3 |
Triethylamine hydrochloride, 98%
CAS: 554-68-7 Molecular Formula: C6H16ClN Molecular Weight (g/mol): 137.65 MDL Number: MFCD00012500 InChI Key: ILWRPSCZWQJDMK-UHFFFAOYSA-N Synonym: triethylamine hydrochloride,triethylammonium chloride,triethylamine hcl,ethanamine, n,n-diethyl-, hydrochloride,triethylamine monohydrochloride,triethylamine, hydrochloride,unii-0nx3818gcw,amine, triethyl, hydrochloride,n,n-diethylethanamine hydrochloride,triethylaminehydrochloride PubChem CID: 11130 IUPAC Name: N,N-diethylethanamine;hydrochloride SMILES: [H+].[Cl-].CCN(CC)CC
| PubChem CID | 11130 |
|---|---|
| CAS | 554-68-7 |
| Molecular Weight (g/mol) | 137.65 |
| MDL Number | MFCD00012500 |
| SMILES | [H+].[Cl-].CCN(CC)CC |
| Synonym | triethylamine hydrochloride,triethylammonium chloride,triethylamine hcl,ethanamine, n,n-diethyl-, hydrochloride,triethylamine monohydrochloride,triethylamine, hydrochloride,unii-0nx3818gcw,amine, triethyl, hydrochloride,n,n-diethylethanamine hydrochloride,triethylaminehydrochloride |
| IUPAC Name | N,N-diethylethanamine;hydrochloride |
| InChI Key | ILWRPSCZWQJDMK-UHFFFAOYSA-N |
| Molecular Formula | C6H16ClN |
3-Diethylaminopropylamine, 99+%
CAS: 104-78-9 Molecular Formula: C7H18N2 Molecular Weight (g/mol): 130.24 MDL Number: MFCD00008218 InChI Key: QOHMWDJIBGVPIF-UHFFFAOYSA-N Synonym: 3-diethylaminopropylamine,3-diethylamino propylamine,n,n-diethyl-1,3-propanediamine,3-aminopropyl diethylamine,n1,n1-diethylpropane-1,3-diamine,1,3-propanediamine, n,n-diethyl,diethylaminotrimethylenamine,n,n-diethyl-1,3-diaminopropane,1-diethylamino propylamine-3,n-3-diethylaminopropyl amine PubChem CID: 61011 IUPAC Name: N',N'-diethylpropane-1,3-diamine SMILES: CCN(CC)CCCN
| PubChem CID | 61011 |
|---|---|
| CAS | 104-78-9 |
| Molecular Weight (g/mol) | 130.24 |
| MDL Number | MFCD00008218 |
| SMILES | CCN(CC)CCCN |
| Synonym | 3-diethylaminopropylamine,3-diethylamino propylamine,n,n-diethyl-1,3-propanediamine,3-aminopropyl diethylamine,n1,n1-diethylpropane-1,3-diamine,1,3-propanediamine, n,n-diethyl,diethylaminotrimethylenamine,n,n-diethyl-1,3-diaminopropane,1-diethylamino propylamine-3,n-3-diethylaminopropyl amine |
| IUPAC Name | N',N'-diethylpropane-1,3-diamine |
| InChI Key | QOHMWDJIBGVPIF-UHFFFAOYSA-N |
| Molecular Formula | C7H18N2 |
Oxamide, 98%
CAS: 471-46-5 Molecular Formula: C2H4N2O2 Molecular Weight (g/mol): 88.06 MDL Number: MFCD00008007 InChI Key: YIKSCQDJHCMVMK-UHFFFAOYSA-N Synonym: ethanediamide,oxalamide,oxamimidic acid,oxalic acid diamide,diaminoglyoxal,oxamid,amid kyseliny stavelove,formimidic acid, 1-carbamoyl,oxamid czech,unii-sbe4m0223e PubChem CID: 10113 ChEBI: CHEBI:48248 IUPAC Name: oxamide SMILES: C(=O)(C(=O)N)N
| PubChem CID | 10113 |
|---|---|
| CAS | 471-46-5 |
| Molecular Weight (g/mol) | 88.06 |
| ChEBI | CHEBI:48248 |
| MDL Number | MFCD00008007 |
| SMILES | C(=O)(C(=O)N)N |
| Synonym | ethanediamide,oxalamide,oxamimidic acid,oxalic acid diamide,diaminoglyoxal,oxamid,amid kyseliny stavelove,formimidic acid, 1-carbamoyl,oxamid czech,unii-sbe4m0223e |
| IUPAC Name | oxamide |
| InChI Key | YIKSCQDJHCMVMK-UHFFFAOYSA-N |
| Molecular Formula | C2H4N2O2 |
Trihexylamine 98.0+%, TCI America™
CAS: 102-86-3 Molecular Formula: C18H39N Molecular Weight (g/mol): 269.517 MDL Number: MFCD00009523 InChI Key: DIAIBWNEUYXDNL-UHFFFAOYSA-N Synonym: tri-n-hexylamine,trihexylamine,1-hexanamine, n,n-dihexyl,c6-c12 trialkylamine,amines, tri-c6-12-alkyl,amine,trihexyl,1-hexanamine,n-dihexyl,1-hexanamine,n,n-dihexyl PubChem CID: 66022 IUPAC Name: N,N-dihexylhexan-1-amine SMILES: CCCCCCN(CCCCCC)CCCCCC
| PubChem CID | 66022 |
|---|---|
| CAS | 102-86-3 |
| Molecular Weight (g/mol) | 269.517 |
| MDL Number | MFCD00009523 |
| SMILES | CCCCCCN(CCCCCC)CCCCCC |
| Synonym | tri-n-hexylamine,trihexylamine,1-hexanamine, n,n-dihexyl,c6-c12 trialkylamine,amines, tri-c6-12-alkyl,amine,trihexyl,1-hexanamine,n-dihexyl,1-hexanamine,n,n-dihexyl |
| IUPAC Name | N,N-dihexylhexan-1-amine |
| InChI Key | DIAIBWNEUYXDNL-UHFFFAOYSA-N |
| Molecular Formula | C18H39N |
Dextran Sulfate Sodium Salt, Colitis Grade (36,000 to 50,000), MP Biomedicals™
Induces severe colitis (inflammatory bowel disease) in laboratory animals
| Boiling Point | 310°C |
|---|---|
| Storage Note 1 | Store at Room Temperature (15°C to 30°C) |
| CAS | 9011-18-1 |
| Moisture | <10% |
| MDL Number | MFCD00081551 |
| Color | White |
| Packaging | Plastic Container |
| Solubility Information | Soluble in water |
| Physical Form | Powder |
| pH | 5 to 7.11 (1% aqueous solution) |
| Grade | Colitis Grade |
| For Use With (Application) | Used for inducing ulcerative colitis in animals and extensively to study colon cancer developing in relation to colonic inflammation |
| Melting Point | 92°C |
1,4-Dichlorobutane, 99%
CAS: 110-56-5 Molecular Formula: C4H8Cl2 Molecular Weight (g/mol): 127.01 MDL Number: MFCD00001011 InChI Key: KJDRSWPQXHESDQ-UHFFFAOYSA-N Synonym: butane, 1,4-dichloro,unii-8326ynm2b3,tetramethylene chloride,1,4-dichlorobutane,butane,4-dichloro,tetramethylene dichloride,1,4-bis chloranyl butane,ksc491k8b,1,4-dichlorobutane, puriss gc PubChem CID: 8059 IUPAC Name: 1,4-dichlorobutane SMILES: ClCCCCCl
| PubChem CID | 8059 |
|---|---|
| CAS | 110-56-5 |
| Molecular Weight (g/mol) | 127.01 |
| MDL Number | MFCD00001011 |
| SMILES | ClCCCCCl |
| Synonym | butane, 1,4-dichloro,unii-8326ynm2b3,tetramethylene chloride,1,4-dichlorobutane,butane,4-dichloro,tetramethylene dichloride,1,4-bis chloranyl butane,ksc491k8b,1,4-dichlorobutane, puriss gc |
| IUPAC Name | 1,4-dichlorobutane |
| InChI Key | KJDRSWPQXHESDQ-UHFFFAOYSA-N |
| Molecular Formula | C4H8Cl2 |
Benzotrifluoride, 99%
CAS: 98-08-8 Molecular Formula: C7H5F3 Molecular Weight (g/mol): 146.112 MDL Number: MFCD00000372 InChI Key: GETTZEONDQJALK-UHFFFAOYSA-N Synonym: benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene PubChem CID: 7368 ChEBI: CHEBI:36810 IUPAC Name: trifluoromethylbenzene SMILES: C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 7368 |
|---|---|
| CAS | 98-08-8 |
| Molecular Weight (g/mol) | 146.112 |
| ChEBI | CHEBI:36810 |
| MDL Number | MFCD00000372 |
| SMILES | C1=CC=C(C=C1)C(F)(F)F |
| Synonym | benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene |
| IUPAC Name | trifluoromethylbenzene |
| InChI Key | GETTZEONDQJALK-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3 |
Sodium 3-nitrobenzenesulfonate, 98%, water <2%
CAS: 127-68-4 Molecular Formula: C6H4NNaO5S Molecular Weight (g/mol): 225.15 MDL Number: MFCD00007490 InChI Key: LJRGBERXYNQPJI-UHFFFAOYSA-M Synonym: sodium 3-nitrobenzenesulfonate,3-nitrobenzenesulfonic acid sodium salt,sodium 3-nitrobenzenesulphonate,sodium m-nitrobenzenesulfonate,nitrol s,tiskan czech,ludigol,ludigol f,60,benzenesulfonic acid, 3-nitro-, sodium salt,unii-1f11sxj4c6 PubChem CID: 31389 IUPAC Name: sodium;3-nitrobenzenesulfonate SMILES: C1=CC(=CC(=C1)S(=O)(=O)[O-])[N+](=O)[O-].[Na+]
| PubChem CID | 31389 |
|---|---|
| CAS | 127-68-4 |
| Molecular Weight (g/mol) | 225.15 |
| MDL Number | MFCD00007490 |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)[O-])[N+](=O)[O-].[Na+] |
| Synonym | sodium 3-nitrobenzenesulfonate,3-nitrobenzenesulfonic acid sodium salt,sodium 3-nitrobenzenesulphonate,sodium m-nitrobenzenesulfonate,nitrol s,tiskan czech,ludigol,ludigol f,60,benzenesulfonic acid, 3-nitro-, sodium salt,unii-1f11sxj4c6 |
| IUPAC Name | sodium;3-nitrobenzenesulfonate |
| InChI Key | LJRGBERXYNQPJI-UHFFFAOYSA-M |
| Molecular Formula | C6H4NNaO5S |
Nordihydroguaiaretic acid, 97%
CAS: 500-38-9 Molecular Formula: C18H22O4 Molecular Weight (g/mol): 302.37 MDL Number: MFCD00002206 InChI Key: HCZKYJDFEPMADG-UHFFFAOYSA-N Synonym: nordihydroguaiaretic acid,ndga,dihydronorguaiaretic acid,norhydroguaiaretic acid,nordihydroguairaretic acid,norguaiaretic acid, dihydro,1,2-benzenediol, 4,4'-2,3-dimethyl-1,4-butanediyl bis,dinorguaiaretic acid, dihydro,4,4'-2,3-dimethyltetramethylene dipyrocatechol,2,3-bis 3,4-dihydroxyphenylmethyl butane PubChem CID: 4534 ChEBI: CHEBI:7625 IUPAC Name: 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol SMILES: CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O
| PubChem CID | 4534 |
|---|---|
| CAS | 500-38-9 |
| Molecular Weight (g/mol) | 302.37 |
| ChEBI | CHEBI:7625 |
| MDL Number | MFCD00002206 |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O |
| Synonym | nordihydroguaiaretic acid,ndga,dihydronorguaiaretic acid,norhydroguaiaretic acid,nordihydroguairaretic acid,norguaiaretic acid, dihydro,1,2-benzenediol, 4,4'-2,3-dimethyl-1,4-butanediyl bis,dinorguaiaretic acid, dihydro,4,4'-2,3-dimethyltetramethylene dipyrocatechol,2,3-bis 3,4-dihydroxyphenylmethyl butane |
| IUPAC Name | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| InChI Key | HCZKYJDFEPMADG-UHFFFAOYSA-N |
| Molecular Formula | C18H22O4 |